C35H36Cl2N3O7S3+ — CID 59916343
2-(N-[7-[(2Z)-5-chloro-2-[[5-chloro-3-(3-sulfopropyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]-1,3-benzothiazol-3-yl]-3-oxoheptyl]-4-formylanilino)propanoic acid (PubChem CID 59916343) has the molecular formula C35H36Cl2N3O7S3+ and a molecular weight of 777.79 g/mol. Its IUPAC name is 2-(N-[7-[(2Z)-5-chloro-2-[[5-chloro-3-(3-sulfopropyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]-1,3-benzothiazol-3-yl]-3-oxoheptyl]-4-formylanilino)propanoic acid.
| Compound Name | 2-(N-[7-[(2Z)-5-chloro-2-[[5-chloro-3-(3-sulfopropyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]-1,3-benzothiazol-3-yl]-3-oxoheptyl]-4-formylanilino)propanoic acid |
|---|---|
| PubChem CID | 59916343 |
| Molecular Formula | C35H36Cl2N3O7S3+ |
| Molecular Weight | 777.79 g/mol |
| Exact Mass | 776.11 |
| IUPAC Name | 2-(N-[7-[(2Z)-5-chloro-2-[[5-chloro-3-(3-sulfopropyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]-1,3-benzothiazol-3-yl]-3-oxoheptyl]-4-formylanilino)propanoic acid |
| SMILES | CC(C(=O)O)N(CCC(=O)CCCCN1/C(=C/c2sc3ccc(Cl)cc3[n+]2CCCS(=O)(=O)O)Sc2ccc(Cl)cc21)c1ccc(C=O)cc1 |
| InChI | InChI=1S/C35H35Cl2N3O7S3/c1-23(35(43)44)38(27-10-6-24(22-41)7-11-27)17-14-28(42)5-2-3-15-39-29-19-25(36)8-12-31(29)48-33(39)21-34-40(16-4-18-50(45,46)47)30-20-26(37)9-13-32(30)49-34/h6-13,19-23H,2-5,14-18H2,1H3,(H-,43,44,45,46,47)/p+1 |
| InChIKey | KDPCQUYSHQZONQ-UHFFFAOYSA-O |
| XLogP | 7.61 |
| TPSA | 136.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.79 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|