C35H37Cl2N4O7S3+ — CID 58817119
2-(N-[3-[4-[5-chloro-2-[[5-chloro-3-(3-sulfopropyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]-1,3-benzothiazol-3-yl]butylamino]-3-oxopropyl]-4-formylanilino)propanoic acid (PubChem CID 58817119) has the molecular formula C35H37Cl2N4O7S3+ and a molecular weight of 792.81 g/mol. Its IUPAC name is 2-(N-[3-[4-[5-chloro-2-[[5-chloro-3-(3-sulfopropyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]-1,3-benzothiazol-3-yl]butylamino]-3-oxopropyl]-4-formylanilino)propanoic acid.
| Compound Name | 2-(N-[3-[4-[5-chloro-2-[[5-chloro-3-(3-sulfopropyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]-1,3-benzothiazol-3-yl]butylamino]-3-oxopropyl]-4-formylanilino)propanoic acid |
|---|---|
| PubChem CID | 58817119 |
| Molecular Formula | C35H37Cl2N4O7S3+ |
| Molecular Weight | 792.81 g/mol |
| Exact Mass | 791.12 |
| IUPAC Name | 2-(N-[3-[4-[5-chloro-2-[[5-chloro-3-(3-sulfopropyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]-1,3-benzothiazol-3-yl]butylamino]-3-oxopropyl]-4-formylanilino)propanoic acid |
| SMILES | CC(C(=O)O)N(CCC(=O)NCCCCN1C(=Cc2sc3ccc(Cl)cc3[n+]2CCCS(=O)(=O)O)Sc2ccc(Cl)cc21)c1ccc(C=O)cc1 |
| InChI | InChI=1S/C35H36Cl2N4O7S3/c1-23(35(44)45)39(27-9-5-24(22-42)6-10-27)17-13-32(43)38-14-2-3-15-40-28-19-25(36)7-11-30(28)49-33(40)21-34-41(16-4-18-51(46,47)48)29-20-26(37)8-12-31(29)50-34/h5-12,19-23H,2-4,13-18H2,1H3,(H2-,38,43,44,45,46,47,48)/p+1 |
| InChIKey | SPDKUTLQFDTBJG-UHFFFAOYSA-O |
| XLogP | 6.76 |
| TPSA | 148.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.81 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|