C32H39N3O3S3+2 — CID 87910425
trimethyl-[3-[5-methyl-2-[2-methyl-3-[1-(3-sulfopropyl)benzo[e][1,3]benzothiazol-1-ium-2-yl]prop-2-enylidene]-1,3-benzothiazol-3-yl]propyl]azanium (PubChem CID 87910425) has the molecular formula C32H39N3O3S3+2 and a molecular weight of 609.88 g/mol. Its IUPAC name is trimethyl-[3-[5-methyl-2-[2-methyl-3-[1-(3-sulfopropyl)benzo[e][1,3]benzothiazol-1-ium-2-yl]prop-2-enylidene]-1,3-benzothiazol-3-yl]propyl]azanium.
| Compound Name | trimethyl-[3-[5-methyl-2-[2-methyl-3-[1-(3-sulfopropyl)benzo[e][1,3]benzothiazol-1-ium-2-yl]prop-2-enylidene]-1,3-benzothiazol-3-yl]propyl]azanium |
|---|---|
| PubChem CID | 87910425 |
| Molecular Formula | C32H39N3O3S3+2 |
| Molecular Weight | 609.88 g/mol |
| Exact Mass | 609.21 |
| IUPAC Name | trimethyl-[3-[5-methyl-2-[2-methyl-3-[1-(3-sulfopropyl)benzo[e][1,3]benzothiazol-1-ium-2-yl]prop-2-enylidene]-1,3-benzothiazol-3-yl]propyl]azanium |
| SMILES | CC(=Cc1sc2ccc3ccccc3c2[n+]1CCCS(=O)(=O)O)C=C1Sc2ccc(C)cc2N1CCC[N+](C)(C)C |
| InChI | InChI=1S/C32H38N3O3S3/c1-23-12-14-28-27(20-23)33(16-8-18-35(3,4)5)30(39-28)21-24(2)22-31-34(17-9-19-41(36,37)38)32-26-11-7-6-10-25(26)13-15-29(32)40-31/h6-7,10-15,20-22H,8-9,16-19H2,1-5H3/q+1/p+1 |
| InChIKey | SVGSXFFIMZZDMJ-UHFFFAOYSA-O |
| XLogP | 6.88 |
| TPSA | 61.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.88 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|