C29H35N2O5S3+ — CID 91604091
6-[5-methyl-2-[2-methyl-3-[5-methyl-3-(3-sulfopropyl)-1,3-benzothiazol-3-ium-2-yl]prop-2-enylidene]-1,3-benzothiazol-3-yl]hexanoic acid (PubChem CID 91604091) has the molecular formula C29H35N2O5S3+ and a molecular weight of 587.81 g/mol. Its IUPAC name is 6-[5-methyl-2-[2-methyl-3-[5-methyl-3-(3-sulfopropyl)-1,3-benzothiazol-3-ium-2-yl]prop-2-enylidene]-1,3-benzothiazol-3-yl]hexanoic acid.
| Compound Name | 6-[5-methyl-2-[2-methyl-3-[5-methyl-3-(3-sulfopropyl)-1,3-benzothiazol-3-ium-2-yl]prop-2-enylidene]-1,3-benzothiazol-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 91604091 |
| Molecular Formula | C29H35N2O5S3+ |
| Molecular Weight | 587.81 g/mol |
| Exact Mass | 587.17 |
| IUPAC Name | 6-[5-methyl-2-[2-methyl-3-[5-methyl-3-(3-sulfopropyl)-1,3-benzothiazol-3-ium-2-yl]prop-2-enylidene]-1,3-benzothiazol-3-yl]hexanoic acid |
| SMILES | CC(=Cc1sc2ccc(C)cc2[n+]1CCCS(=O)(=O)O)C=C1Sc2ccc(C)cc2N1CCCCCC(=O)O |
| InChI | InChI=1S/C29H34N2O5S3/c1-20-9-11-25-23(16-20)30(13-6-4-5-8-29(32)33)27(37-25)18-22(3)19-28-31(14-7-15-39(34,35)36)24-17-21(2)10-12-26(24)38-28/h9-12,16-19H,4-8,13-15H2,1-3H3,(H-,32,33,34,35,36)/p+1 |
| InChIKey | VLZJMSPIKFUVRP-UHFFFAOYSA-O |
| XLogP | 6.59 |
| TPSA | 98.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.81 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|