C26H25N2O7S4+ — CID 59055979
3-[5-formyl-2-[[1-(3-sulfinooxypropyl)benzo[e][1,3]benzothiazol-1-ium-2-yl]methylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid (PubChem CID 59055979) has the molecular formula C26H25N2O7S4+ and a molecular weight of 605.76 g/mol. Its IUPAC name is 3-[5-formyl-2-[[1-(3-sulfinooxypropyl)benzo[e][1,3]benzothiazol-1-ium-2-yl]methylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid.
| Compound Name | 3-[5-formyl-2-[[1-(3-sulfinooxypropyl)benzo[e][1,3]benzothiazol-1-ium-2-yl]methylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 59055979 |
| Molecular Formula | C26H25N2O7S4+ |
| Molecular Weight | 605.76 g/mol |
| Exact Mass | 605.05 |
| IUPAC Name | 3-[5-formyl-2-[[1-(3-sulfinooxypropyl)benzo[e][1,3]benzothiazol-1-ium-2-yl]methylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid |
| SMILES | O=Cc1ccc2c(c1)N(CCCS(=O)(=O)O)C(=Cc1sc3ccc4ccccc4c3[n+]1CCCOS(=O)O)S2 |
| InChI | InChI=1S/C26H24N2O7S4/c29-17-18-7-9-22-21(15-18)27(12-4-14-39(32,33)34)24(36-22)16-25-28(11-3-13-35-38(30)31)26-20-6-2-1-5-19(20)8-10-23(26)37-25/h1-2,5-10,15-17H,3-4,11-14H2,(H-,30,31,32,33,34)/p+1 |
| InChIKey | KXFDEUQAZHDOQB-UHFFFAOYSA-O |
| XLogP | 4.89 |
| TPSA | 125.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.76 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|