C23H27N2O8S4+ — CID 59910809
3-[5-methoxy-2-[[5-methoxy-3-(3-sulfinooxypropyl)-1,3-benzothiazol-2-ylidene]methyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonic acid (PubChem CID 59910809) has the molecular formula C23H27N2O8S4+ and a molecular weight of 587.74 g/mol. Its IUPAC name is 3-[5-methoxy-2-[[5-methoxy-3-(3-sulfinooxypropyl)-1,3-benzothiazol-2-ylidene]methyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonic acid.
| Compound Name | 3-[5-methoxy-2-[[5-methoxy-3-(3-sulfinooxypropyl)-1,3-benzothiazol-2-ylidene]methyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 59910809 |
| Molecular Formula | C23H27N2O8S4+ |
| Molecular Weight | 587.74 g/mol |
| Exact Mass | 587.06 |
| IUPAC Name | 3-[5-methoxy-2-[[5-methoxy-3-(3-sulfinooxypropyl)-1,3-benzothiazol-2-ylidene]methyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonic acid |
| SMILES | COc1ccc2c(c1)N(CCCOS(=O)O)C(=Cc1sc3ccc(OC)cc3[n+]1CCCS(=O)(=O)O)S2 |
| InChI | InChI=1S/C23H26N2O8S4/c1-31-16-5-7-20-18(13-16)24(9-3-11-33-36(26)27)22(34-20)15-23-25(10-4-12-37(28,29)30)19-14-17(32-2)6-8-21(19)35-23/h5-8,13-15H,3-4,9-12H2,1-2H3,(H-,26,27,28,29,30)/p+1 |
| InChIKey | LGZJWWBKJOYQAX-UHFFFAOYSA-O |
| XLogP | 3.94 |
| TPSA | 126.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.74 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|