C20H22NO5S3+ — CID 3109020
2-[1-[1-(3-sulfopropyl)benzo[e][1,3]benzothiazol-1-ium-2-yl]but-1-en-2-ylsulfanyl]acetic acid (PubChem CID 3109020) has the molecular formula C20H22NO5S3+ and a molecular weight of 452.60 g/mol. Its IUPAC name is 2-[1-[1-(3-sulfopropyl)benzo[e][1,3]benzothiazol-1-ium-2-yl]but-1-en-2-ylsulfanyl]acetic acid.
| Compound Name | 2-[1-[1-(3-sulfopropyl)benzo[e][1,3]benzothiazol-1-ium-2-yl]but-1-en-2-ylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 3109020 |
| Molecular Formula | C20H22NO5S3+ |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | 2-[1-[1-(3-sulfopropyl)benzo[e][1,3]benzothiazol-1-ium-2-yl]but-1-en-2-ylsulfanyl]acetic acid |
| SMILES | CCC(=Cc1sc2ccc3ccccc3c2[n+]1CCCS(=O)(=O)O)SCC(=O)O |
| InChI | InChI=1S/C20H21NO5S3/c1-2-15(27-13-19(22)23)12-18-21(10-5-11-29(24,25)26)20-16-7-4-3-6-14(16)8-9-17(20)28-18/h3-4,6-9,12H,2,5,10-11,13H2,1H3,(H-,22,23,24,25,26)/p+1 |
| InChIKey | WKAJEMPMELIQSU-UHFFFAOYSA-O |
| XLogP | 4.19 |
| TPSA | 95.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|