C20H23N2O3S2+ — CID 59956009
3-[2-[(1-methylpyrrolidin-2-ylidene)methyl]benzo[e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonic acid (PubChem CID 59956009) has the molecular formula C20H23N2O3S2+ and a molecular weight of 403.55 g/mol. Its IUPAC name is 3-[2-[(1-methylpyrrolidin-2-ylidene)methyl]benzo[e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[2-[(1-methylpyrrolidin-2-ylidene)methyl]benzo[e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 59956009 |
| Molecular Formula | C20H23N2O3S2+ |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 3-[2-[(1-methylpyrrolidin-2-ylidene)methyl]benzo[e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonic acid |
| SMILES | CN1CCCC1=Cc1sc2ccc3ccccc3c2[n+]1CCCS(=O)(=O)O |
| InChI | InChI=1S/C20H22N2O3S2/c1-21-11-4-7-16(21)14-19-22(12-5-13-27(23,24)25)20-17-8-3-2-6-15(17)9-10-18(20)26-19/h2-3,6,8-10,14H,4-5,7,11-13H2,1H3/p+1 |
| InChIKey | VCOVWIRGQPYYIF-UHFFFAOYSA-O |
| XLogP | 3.69 |
| TPSA | 61.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|