C30H35N3O6S2 — CID 10009018
3-[(2Z)-2-[(E)-4-(1,3-dibutyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)but-2-enylidene]benzo[e][1,3]benzoxazol-1-yl]propane-1-sulfonic acid (PubChem CID 10009018) has the molecular formula C30H35N3O6S2 and a molecular weight of 597.76 g/mol. Its IUPAC name is 3-[(2Z)-2-[(E)-4-(1,3-dibutyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)but-2-enylidene]benzo[e][1,3]benzoxazol-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[(2Z)-2-[(E)-4-(1,3-dibutyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)but-2-enylidene]benzo[e][1,3]benzoxazol-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 10009018 |
| Molecular Formula | C30H35N3O6S2 |
| Molecular Weight | 597.76 g/mol |
| Exact Mass | 597.20 |
| IUPAC Name | 3-[(2Z)-2-[(E)-4-(1,3-dibutyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)but-2-enylidene]benzo[e][1,3]benzoxazol-1-yl]propane-1-sulfonic acid |
| SMILES | CCCCN1C(=O)C(=C/C=C/C=C2\Oc3ccc4ccccc4c3N2CCCS(=O)(=O)O)C(=O)N(CCCC)C1=S |
| InChI | InChI=1S/C30H35N3O6S2/c1-3-5-18-32-28(34)24(29(35)33(30(32)40)19-6-4-2)14-9-10-15-26-31(20-11-21-41(36,37)38)27-23-13-8-7-12-22(23)16-17-25(27)39-26/h7-10,12-17H,3-6,11,18-21H2,1-2H3,(H,36,37,38)/b10-9+,26-15- |
| InChIKey | CQNJKZKYABOISK-CQHVYDDXSA-N |
| XLogP | 5.20 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.76 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|