C32H39N3O5S3 — CID 3006058
3-[2-[4-(1-decyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)but-2-enylidene]benzo[g][1,3]benzothiazol-3-yl]propane-1-sulfonic acid (PubChem CID 3006058) has the molecular formula C32H39N3O5S3 and a molecular weight of 641.88 g/mol. Its IUPAC name is 3-[2-[4-(1-decyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)but-2-enylidene]benzo[g][1,3]benzothiazol-3-yl]propane-1-sulfonic acid.
| Compound Name | 3-[2-[4-(1-decyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)but-2-enylidene]benzo[g][1,3]benzothiazol-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 3006058 |
| Molecular Formula | C32H39N3O5S3 |
| Molecular Weight | 641.88 g/mol |
| Exact Mass | 641.21 |
| IUPAC Name | 3-[2-[4-(1-decyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)but-2-enylidene]benzo[g][1,3]benzothiazol-3-yl]propane-1-sulfonic acid |
| SMILES | CCCCCCCCCCN1C(=O)C(=CC=CC=C2Sc3c(ccc4ccccc34)N2CCCS(=O)(=O)O)C(=O)NC1=S |
| InChI | InChI=1S/C32H39N3O5S3/c1-2-3-4-5-6-7-8-13-21-35-31(37)26(30(36)33-32(35)41)17-11-12-18-28-34(22-14-23-43(38,39)40)27-20-19-24-15-9-10-16-25(24)29(27)42-28/h9-12,15-20H,2-8,13-14,21-23H2,1H3,(H,33,36,41)(H,38,39,40) |
| InChIKey | DWSNVCZTNUUPMM-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.88 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|