C27H33NO5S2 — CID 58625612
3-[2-[4-(3,5-diethyl-2,6-dioxo-4-sulfanylidenecyclohexylidene)but-2-enylidene]-3,3-dimethylindol-1-yl]propane-1-sulfonic acid (PubChem CID 58625612) has the molecular formula C27H33NO5S2 and a molecular weight of 515.70 g/mol. Its IUPAC name is 3-[2-[4-(3,5-diethyl-2,6-dioxo-4-sulfanylidenecyclohexylidene)but-2-enylidene]-3,3-dimethylindol-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[2-[4-(3,5-diethyl-2,6-dioxo-4-sulfanylidenecyclohexylidene)but-2-enylidene]-3,3-dimethylindol-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 58625612 |
| Molecular Formula | C27H33NO5S2 |
| Molecular Weight | 515.70 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | 3-[2-[4-(3,5-diethyl-2,6-dioxo-4-sulfanylidenecyclohexylidene)but-2-enylidene]-3,3-dimethylindol-1-yl]propane-1-sulfonic acid |
| SMILES | CCC1C(=O)C(=CC=CC=C2N(CCCS(=O)(=O)O)c3ccccc3C2(C)C)C(=O)C(CC)C1=S |
| InChI | InChI=1S/C27H33NO5S2/c1-5-18-24(29)20(25(30)19(6-2)26(18)34)12-7-10-15-23-27(3,4)21-13-8-9-14-22(21)28(23)16-11-17-35(31,32)33/h7-10,12-15,18-19H,5-6,11,16-17H2,1-4H3,(H,31,32,33) |
| InChIKey | CTVRNQIZDWYDAK-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.70 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|