C43H54N2O — CID 58700813
2,5-bis[4-(3,3-dimethyl-1-pentylindol-2-ylidene)but-2-enylidene]cyclopentan-1-one (PubChem CID 58700813) has the molecular formula C43H54N2O and a molecular weight of 614.92 g/mol. Its IUPAC name is 2,5-bis[4-(3,3-dimethyl-1-pentylindol-2-ylidene)but-2-enylidene]cyclopentan-1-one.
| Compound Name | 2,5-bis[4-(3,3-dimethyl-1-pentylindol-2-ylidene)but-2-enylidene]cyclopentan-1-one |
|---|---|
| PubChem CID | 58700813 |
| Molecular Formula | C43H54N2O |
| Molecular Weight | 614.92 g/mol |
| Exact Mass | 614.42 |
| IUPAC Name | 2,5-bis[4-(3,3-dimethyl-1-pentylindol-2-ylidene)but-2-enylidene]cyclopentan-1-one |
| SMILES | CCCCCN1C(=CC=CC=C2CCC(=CC=CC=C3N(CCCCC)c4ccccc4C3(C)C)C2=O)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C43H54N2O/c1-7-9-19-31-44-37-25-15-13-23-35(37)42(3,4)39(44)27-17-11-21-33-29-30-34(41(33)46)22-12-18-28-40-43(5,6)36-24-14-16-26-38(36)45(40)32-20-10-8-2/h11-18,21-28H,7-10,19-20,29-32H2,1-6H3 |
| InChIKey | XEXNDQYHMUUXFJ-UHFFFAOYSA-N |
| XLogP | 11.06 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.92 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|