C24H29NO4 — CID 123956019
8-[2-(1-butyl-3,3-dimethylindol-2-ylidene)ethylidene]-6,10-dioxaspiro[4.5]decane-7,9-dione (PubChem CID 123956019) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is 8-[2-(1-butyl-3,3-dimethylindol-2-ylidene)ethylidene]-6,10-dioxaspiro[4.5]decane-7,9-dione.
| Compound Name | 8-[2-(1-butyl-3,3-dimethylindol-2-ylidene)ethylidene]-6,10-dioxaspiro[4.5]decane-7,9-dione |
|---|---|
| PubChem CID | 123956019 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 8-[2-(1-butyl-3,3-dimethylindol-2-ylidene)ethylidene]-6,10-dioxaspiro[4.5]decane-7,9-dione |
| SMILES | CCCCN1C(=CC=C2C(=O)OC3(CCCC3)OC2=O)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C24H29NO4/c1-4-5-16-25-19-11-7-6-10-18(19)23(2,3)20(25)13-12-17-21(26)28-24(29-22(17)27)14-8-9-15-24/h6-7,10-13H,4-5,8-9,14-16H2,1-3H3 |
| InChIKey | HHQSXCPZELOVQP-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|