C34H44N2O — CID 58659962
(2E,6E)-2,6-bis(1-butyl-3,3-dimethylindol-2-ylidene)cyclohexan-1-one (PubChem CID 58659962) has the molecular formula C34H44N2O and a molecular weight of 496.74 g/mol. Its IUPAC name is (2E,6E)-2,6-bis(1-butyl-3,3-dimethylindol-2-ylidene)cyclohexan-1-one.
| Compound Name | (2E,6E)-2,6-bis(1-butyl-3,3-dimethylindol-2-ylidene)cyclohexan-1-one |
|---|---|
| PubChem CID | 58659962 |
| Molecular Formula | C34H44N2O |
| Molecular Weight | 496.74 g/mol |
| Exact Mass | 496.35 |
| IUPAC Name | (2E,6E)-2,6-bis(1-butyl-3,3-dimethylindol-2-ylidene)cyclohexan-1-one |
| SMILES | CCCCN1/C(=C2\CCC/C(=C3\N(CCCC)c4ccccc4C3(C)C)C2=O)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C34H44N2O/c1-7-9-22-35-28-20-13-11-18-26(28)33(3,4)31(35)24-16-15-17-25(30(24)37)32-34(5,6)27-19-12-14-21-29(27)36(32)23-10-8-2/h11-14,18-21H,7-10,15-17,22-23H2,1-6H3/b31-24+,32-25+ |
| InChIKey | XBAFMBTUFIQWIX-UXPPBCCBSA-N |
| XLogP | 8.44 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.74 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|