C14H19NO2 — CID 66707162
1-(3-methoxypropyl)-3,3-dimethylindol-2-one (PubChem CID 66707162) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-3,3-dimethylindol-2-one.
| Compound Name | 1-(3-methoxypropyl)-3,3-dimethylindol-2-one |
|---|---|
| PubChem CID | 66707162 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 1-(3-methoxypropyl)-3,3-dimethylindol-2-one |
| SMILES | COCCCN1C(=O)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C14H19NO2/c1-14(2)11-7-4-5-8-12(11)15(13(14)16)9-6-10-17-3/h4-5,7-8H,6,9-10H2,1-3H3 |
| InChIKey | UCUNZFRKZPOIPS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|