C16H23NO3 — CID 80500352
1-(2,2-diethoxyethyl)-3,3-dimethylindol-2-one (PubChem CID 80500352) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is 1-(2,2-diethoxyethyl)-3,3-dimethylindol-2-one.
| Compound Name | 1-(2,2-diethoxyethyl)-3,3-dimethylindol-2-one |
|---|---|
| PubChem CID | 80500352 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 1-(2,2-diethoxyethyl)-3,3-dimethylindol-2-one |
| SMILES | CCOC(CN1C(=O)C(C)(C)c2ccccc21)OCC |
| InChI | InChI=1S/C16H23NO3/c1-5-19-14(20-6-2)11-17-13-10-8-7-9-12(13)16(3,4)15(17)18/h7-10,14H,5-6,11H2,1-4H3 |
| InChIKey | UUZZNAXBWOIWIT-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|