C31H37N5O5 — CID 22013040
2-[1-(2,2-diethoxyethyl)-3-[(4-methylphenyl)carbamoylamino]-2-oxoindol-3-yl]-N-[4-(methylamino)phenyl]acetamide (PubChem CID 22013040) has the molecular formula C31H37N5O5 and a molecular weight of 559.67 g/mol. Its IUPAC name is 2-[1-(2,2-diethoxyethyl)-3-[(4-methylphenyl)carbamoylamino]-2-oxoindol-3-yl]-N-[4-(methylamino)phenyl]acetamide.
| Compound Name | 2-[1-(2,2-diethoxyethyl)-3-[(4-methylphenyl)carbamoylamino]-2-oxoindol-3-yl]-N-[4-(methylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 22013040 |
| Molecular Formula | C31H37N5O5 |
| Molecular Weight | 559.67 g/mol |
| Exact Mass | 559.28 |
| IUPAC Name | 2-[1-(2,2-diethoxyethyl)-3-[(4-methylphenyl)carbamoylamino]-2-oxoindol-3-yl]-N-[4-(methylamino)phenyl]acetamide |
| SMILES | CCOC(CN1C(=O)C(CC(=O)Nc2ccc(NC)cc2)(NC(=O)Nc2ccc(C)cc2)c2ccccc21)OCC |
| InChI | InChI=1S/C31H37N5O5/c1-5-40-28(41-6-2)20-36-26-10-8-7-9-25(26)31(29(36)38,35-30(39)34-24-13-11-21(3)12-14-24)19-27(37)33-23-17-15-22(32-4)16-18-23/h7-18,28,32H,5-6,19-20H2,1-4H3,(H,33,37)(H2,34,35,39) |
| InChIKey | CFLPPZIXQJGBCF-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 121.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.67 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|