C30H33ClN4O5 — CID 70146090
N-(4-chlorophenyl)-2-[(3S)-1-(2,2-diethoxyethyl)-3-[(4-methylphenyl)carbamoylamino]-2-oxoindol-3-yl]acetamide (PubChem CID 70146090) has the molecular formula C30H33ClN4O5 and a molecular weight of 565.07 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[(3S)-1-(2,2-diethoxyethyl)-3-[(4-methylphenyl)carbamoylamino]-2-oxoindol-3-yl]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[(3S)-1-(2,2-diethoxyethyl)-3-[(4-methylphenyl)carbamoylamino]-2-oxoindol-3-yl]acetamide |
|---|---|
| PubChem CID | 70146090 |
| Molecular Formula | C30H33ClN4O5 |
| Molecular Weight | 565.07 g/mol |
| Exact Mass | 564.21 |
| IUPAC Name | N-(4-chlorophenyl)-2-[(3S)-1-(2,2-diethoxyethyl)-3-[(4-methylphenyl)carbamoylamino]-2-oxoindol-3-yl]acetamide |
| SMILES | CCOC(CN1C(=O)[C@@](CC(=O)Nc2ccc(Cl)cc2)(NC(=O)Nc2ccc(C)cc2)c2ccccc21)OCC |
| InChI | InChI=1S/C30H33ClN4O5/c1-4-39-27(40-5-2)19-35-25-9-7-6-8-24(25)30(28(35)37,18-26(36)32-22-16-12-21(31)13-17-22)34-29(38)33-23-14-10-20(3)11-15-23/h6-17,27H,4-5,18-19H2,1-3H3,(H,32,36)(H2,33,34,38)/t30-/m0/s1 |
| InChIKey | ICJCHYAYYVIPPC-PMERELPUSA-N |
| XLogP | 5.44 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.07 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|