C37H50N4O6Si — CID 18345354
2-[3-[[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]carbamoylamino]-1-(2,2-diethoxyethyl)-2-oxoindol-3-yl]-N-(4-methylphenyl)acetamide (PubChem CID 18345354) has the molecular formula C37H50N4O6Si and a molecular weight of 674.92 g/mol. Its IUPAC name is 2-[3-[[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]carbamoylamino]-1-(2,2-diethoxyethyl)-2-oxoindol-3-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[3-[[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]carbamoylamino]-1-(2,2-diethoxyethyl)-2-oxoindol-3-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 18345354 |
| Molecular Formula | C37H50N4O6Si |
| Molecular Weight | 674.92 g/mol |
| Exact Mass | 674.35 |
| IUPAC Name | 2-[3-[[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]carbamoylamino]-1-(2,2-diethoxyethyl)-2-oxoindol-3-yl]-N-(4-methylphenyl)acetamide |
| SMILES | CCOC(CN1C(=O)C(CC(=O)Nc2ccc(C)cc2)(NC(=O)Nc2ccc(CO[Si](C)(C)C(C)(C)C)cc2)c2ccccc21)OCC |
| InChI | InChI=1S/C37H50N4O6Si/c1-9-45-33(46-10-2)24-41-31-14-12-11-13-30(31)37(34(41)43,23-32(42)38-28-19-15-26(3)16-20-28)40-35(44)39-29-21-17-27(18-22-29)25-47-48(7,8)36(4,5)6/h11-22,33H,9-10,23-25H2,1-8H3,(H,38,42)(H2,39,40,44) |
| InChIKey | DKMJEBPRIRIMGF-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 118.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.92 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|