C32H38N4O5 — CID 70146399
2-[(3S)-1-(2,2-diethoxyethyl)-3-[(4-methylphenyl)carbamoylamino]-2-oxoindol-3-yl]-N-(3,4-dimethylphenyl)acetamide (PubChem CID 70146399) has the molecular formula C32H38N4O5 and a molecular weight of 558.68 g/mol. Its IUPAC name is 2-[(3S)-1-(2,2-diethoxyethyl)-3-[(4-methylphenyl)carbamoylamino]-2-oxoindol-3-yl]-N-(3,4-dimethylphenyl)acetamide.
| Compound Name | 2-[(3S)-1-(2,2-diethoxyethyl)-3-[(4-methylphenyl)carbamoylamino]-2-oxoindol-3-yl]-N-(3,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 70146399 |
| Molecular Formula | C32H38N4O5 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.28 |
| IUPAC Name | 2-[(3S)-1-(2,2-diethoxyethyl)-3-[(4-methylphenyl)carbamoylamino]-2-oxoindol-3-yl]-N-(3,4-dimethylphenyl)acetamide |
| SMILES | CCOC(CN1C(=O)[C@@](CC(=O)Nc2ccc(C)c(C)c2)(NC(=O)Nc2ccc(C)cc2)c2ccccc21)OCC |
| InChI | InChI=1S/C32H38N4O5/c1-6-40-29(41-7-2)20-36-27-11-9-8-10-26(27)32(30(36)38,35-31(39)34-24-15-12-21(3)13-16-24)19-28(37)33-25-17-14-22(4)23(5)18-25/h8-18,29H,6-7,19-20H2,1-5H3,(H,33,37)(H2,34,35,39)/t32-/m0/s1 |
| InChIKey | DKBDTOQXRQOITP-YTTGMZPUSA-N |
| XLogP | 5.40 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|