C36H46N4O5 — CID 22013081
2-[1-(2,2-diethoxyethyl)-3-[(4-methylphenyl)carbamoylamino]-2-oxoindol-3-yl]-N-(4-hexylphenyl)acetamide (PubChem CID 22013081) has the molecular formula C36H46N4O5 and a molecular weight of 614.79 g/mol. Its IUPAC name is 2-[1-(2,2-diethoxyethyl)-3-[(4-methylphenyl)carbamoylamino]-2-oxoindol-3-yl]-N-(4-hexylphenyl)acetamide.
| Compound Name | 2-[1-(2,2-diethoxyethyl)-3-[(4-methylphenyl)carbamoylamino]-2-oxoindol-3-yl]-N-(4-hexylphenyl)acetamide |
|---|---|
| PubChem CID | 22013081 |
| Molecular Formula | C36H46N4O5 |
| Molecular Weight | 614.79 g/mol |
| Exact Mass | 614.35 |
| IUPAC Name | 2-[1-(2,2-diethoxyethyl)-3-[(4-methylphenyl)carbamoylamino]-2-oxoindol-3-yl]-N-(4-hexylphenyl)acetamide |
| SMILES | CCCCCCc1ccc(NC(=O)CC2(NC(=O)Nc3ccc(C)cc3)C(=O)N(CC(OCC)OCC)c3ccccc32)cc1 |
| InChI | InChI=1S/C36H46N4O5/c1-5-8-9-10-13-27-18-22-28(23-19-27)37-32(41)24-36(39-35(43)38-29-20-16-26(4)17-21-29)30-14-11-12-15-31(30)40(34(36)42)25-33(44-6-2)45-7-3/h11-12,14-23,33H,5-10,13,24-25H2,1-4H3,(H,37,41)(H2,38,39,43) |
| InChIKey | CURYQWQDWSDFGK-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.79 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|