C31H34Cl2N4O5 — CID 10232661
2-[(3S)-1-[2,2-bis(2-chloroethoxy)ethyl]-3-[(4-methylphenyl)carbamoylamino]-2-oxoindol-3-yl]-N-(4-methylphenyl)acetamide (PubChem CID 10232661) has the molecular formula C31H34Cl2N4O5 and a molecular weight of 613.54 g/mol. Its IUPAC name is 2-[(3S)-1-[2,2-bis(2-chloroethoxy)ethyl]-3-[(4-methylphenyl)carbamoylamino]-2-oxoindol-3-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[(3S)-1-[2,2-bis(2-chloroethoxy)ethyl]-3-[(4-methylphenyl)carbamoylamino]-2-oxoindol-3-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 10232661 |
| Molecular Formula | C31H34Cl2N4O5 |
| Molecular Weight | 613.54 g/mol |
| Exact Mass | 612.19 |
| IUPAC Name | 2-[(3S)-1-[2,2-bis(2-chloroethoxy)ethyl]-3-[(4-methylphenyl)carbamoylamino]-2-oxoindol-3-yl]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)C[C@@]2(NC(=O)Nc3ccc(C)cc3)C(=O)N(CC(OCCCl)OCCCl)c3ccccc32)cc1 |
| InChI | InChI=1S/C31H34Cl2N4O5/c1-21-7-11-23(12-8-21)34-27(38)19-31(36-30(40)35-24-13-9-22(2)10-14-24)25-5-3-4-6-26(25)37(29(31)39)20-28(41-17-15-32)42-18-16-33/h3-14,28H,15-20H2,1-2H3,(H,34,38)(H2,35,36,40)/t31-/m0/s1 |
| InChIKey | OZBDZMOXTFFWEK-HKBQPEDESA-N |
| XLogP | 5.53 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.54 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|