C31H36N4O6 — CID 23293136
2-[1-(2,2-diethoxyethyl)-3-[(4-methoxyphenyl)carbamoylamino]-2-oxoindol-3-yl]-N-(4-methylphenyl)acetamide (PubChem CID 23293136) has the molecular formula C31H36N4O6 and a molecular weight of 560.65 g/mol. Its IUPAC name is 2-[1-(2,2-diethoxyethyl)-3-[(4-methoxyphenyl)carbamoylamino]-2-oxoindol-3-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[1-(2,2-diethoxyethyl)-3-[(4-methoxyphenyl)carbamoylamino]-2-oxoindol-3-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 23293136 |
| Molecular Formula | C31H36N4O6 |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.26 |
| IUPAC Name | 2-[1-(2,2-diethoxyethyl)-3-[(4-methoxyphenyl)carbamoylamino]-2-oxoindol-3-yl]-N-(4-methylphenyl)acetamide |
| SMILES | CCOC(CN1C(=O)C(CC(=O)Nc2ccc(C)cc2)(NC(=O)Nc2ccc(OC)cc2)c2ccccc21)OCC |
| InChI | InChI=1S/C31H36N4O6/c1-5-40-28(41-6-2)20-35-26-10-8-7-9-25(26)31(29(35)37,19-27(36)32-22-13-11-21(3)12-14-22)34-30(38)33-23-15-17-24(39-4)18-16-23/h7-18,28H,5-6,19-20H2,1-4H3,(H,32,36)(H2,33,34,38) |
| InChIKey | XUSXQSQCCQOIMA-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 118.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|