C26H33N3O7 — CID 22013006
ethyl 2-[1-(2,2-diethoxyethyl)-3-[(3-methoxyphenyl)carbamoylamino]-2-oxoindol-3-yl]acetate (PubChem CID 22013006) has the molecular formula C26H33N3O7 and a molecular weight of 499.56 g/mol. Its IUPAC name is ethyl 2-[1-(2,2-diethoxyethyl)-3-[(3-methoxyphenyl)carbamoylamino]-2-oxoindol-3-yl]acetate.
| Compound Name | ethyl 2-[1-(2,2-diethoxyethyl)-3-[(3-methoxyphenyl)carbamoylamino]-2-oxoindol-3-yl]acetate |
|---|---|
| PubChem CID | 22013006 |
| Molecular Formula | C26H33N3O7 |
| Molecular Weight | 499.56 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | ethyl 2-[1-(2,2-diethoxyethyl)-3-[(3-methoxyphenyl)carbamoylamino]-2-oxoindol-3-yl]acetate |
| SMILES | CCOC(=O)CC1(NC(=O)Nc2cccc(OC)c2)C(=O)N(CC(OCC)OCC)c2ccccc21 |
| InChI | InChI=1S/C26H33N3O7/c1-5-34-22(30)16-26(28-25(32)27-18-11-10-12-19(15-18)33-4)20-13-8-9-14-21(20)29(24(26)31)17-23(35-6-2)36-7-3/h8-15,23H,5-7,16-17H2,1-4H3,(H2,27,28,32) |
| InChIKey | JURHKBOAIZNYGE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.56 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|