C34H47N3O7 — CID 22013008
(5-methyl-2-propan-2-ylcyclohexyl) 2-[1-(2,2-diethoxyethyl)-3-[(3-methoxyphenyl)carbamoylamino]-2-oxoindol-3-yl]acetate (PubChem CID 22013008) has the molecular formula C34H47N3O7 and a molecular weight of 609.76 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 2-[1-(2,2-diethoxyethyl)-3-[(3-methoxyphenyl)carbamoylamino]-2-oxoindol-3-yl]acetate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-[1-(2,2-diethoxyethyl)-3-[(3-methoxyphenyl)carbamoylamino]-2-oxoindol-3-yl]acetate |
|---|---|
| PubChem CID | 22013008 |
| Molecular Formula | C34H47N3O7 |
| Molecular Weight | 609.76 g/mol |
| Exact Mass | 609.34 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-[1-(2,2-diethoxyethyl)-3-[(3-methoxyphenyl)carbamoylamino]-2-oxoindol-3-yl]acetate |
| SMILES | CCOC(CN1C(=O)C(CC(=O)OC2CC(C)CCC2C(C)C)(NC(=O)Nc2cccc(OC)c2)c2ccccc21)OCC |
| InChI | InChI=1S/C34H47N3O7/c1-7-42-31(43-8-2)21-37-28-15-10-9-14-27(28)34(32(37)39,36-33(40)35-24-12-11-13-25(19-24)41-6)20-30(38)44-29-18-23(5)16-17-26(29)22(3)4/h9-15,19,22-23,26,29,31H,7-8,16-18,20-21H2,1-6H3,(H2,35,36,40) |
| InChIKey | BXEIIAPISJCSAT-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.76 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|