C32H36N4O7 — CID 70145363
2-[4-[2-amino-1-[1-(2,2-diethoxyethyl)-3-[(4-methylphenyl)carbamoylamino]-2-oxoindol-3-yl]-2-oxoethyl]phenyl]acetic acid (PubChem CID 70145363) has the molecular formula C32H36N4O7 and a molecular weight of 588.66 g/mol. Its IUPAC name is 2-[4-[2-amino-1-[1-(2,2-diethoxyethyl)-3-[(4-methylphenyl)carbamoylamino]-2-oxoindol-3-yl]-2-oxoethyl]phenyl]acetic acid.
| Compound Name | 2-[4-[2-amino-1-[1-(2,2-diethoxyethyl)-3-[(4-methylphenyl)carbamoylamino]-2-oxoindol-3-yl]-2-oxoethyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 70145363 |
| Molecular Formula | C32H36N4O7 |
| Molecular Weight | 588.66 g/mol |
| Exact Mass | 588.26 |
| IUPAC Name | 2-[4-[2-amino-1-[1-(2,2-diethoxyethyl)-3-[(4-methylphenyl)carbamoylamino]-2-oxoindol-3-yl]-2-oxoethyl]phenyl]acetic acid |
| SMILES | CCOC(CN1C(=O)C(NC(=O)Nc2ccc(C)cc2)(C(C(N)=O)c2ccc(CC(=O)O)cc2)c2ccccc21)OCC |
| InChI | InChI=1S/C32H36N4O7/c1-4-42-27(43-5-2)19-36-25-9-7-6-8-24(25)32(30(36)40,35-31(41)34-23-16-10-20(3)11-17-23)28(29(33)39)22-14-12-21(13-15-22)18-26(37)38/h6-17,27-28H,4-5,18-19H2,1-3H3,(H2,33,39)(H,37,38)(H2,34,35,41) |
| InChIKey | LJKSYOOLCLZRGZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 160.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.66 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|