C30H35N5O5 — CID 70143759
2-[3-[(4-aminophenyl)carbamoylamino]-1-(2,2-diethoxyethyl)-2-oxoindol-3-yl]-2-(4-methylphenyl)acetamide (PubChem CID 70143759) has the molecular formula C30H35N5O5 and a molecular weight of 545.64 g/mol. Its IUPAC name is 2-[3-[(4-aminophenyl)carbamoylamino]-1-(2,2-diethoxyethyl)-2-oxoindol-3-yl]-2-(4-methylphenyl)acetamide.
| Compound Name | 2-[3-[(4-aminophenyl)carbamoylamino]-1-(2,2-diethoxyethyl)-2-oxoindol-3-yl]-2-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 70143759 |
| Molecular Formula | C30H35N5O5 |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.26 |
| IUPAC Name | 2-[3-[(4-aminophenyl)carbamoylamino]-1-(2,2-diethoxyethyl)-2-oxoindol-3-yl]-2-(4-methylphenyl)acetamide |
| SMILES | CCOC(CN1C(=O)C(NC(=O)Nc2ccc(N)cc2)(C(C(N)=O)c2ccc(C)cc2)c2ccccc21)OCC |
| InChI | InChI=1S/C30H35N5O5/c1-4-39-25(40-5-2)18-35-24-9-7-6-8-23(24)30(28(35)37,26(27(32)36)20-12-10-19(3)11-13-20)34-29(38)33-22-16-14-21(31)15-17-22/h6-17,25-26H,4-5,18,31H2,1-3H3,(H2,32,36)(H2,33,34,38) |
| InChIKey | JPPSRCCBDYWOSJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 149.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|