C31H33N5O5 — CID 70147542
2-[3-[(4-cyanophenyl)carbamoylamino]-1-(2,2-diethoxyethyl)-2-oxoindol-3-yl]-2-(4-methylphenyl)acetamide (PubChem CID 70147542) has the molecular formula C31H33N5O5 and a molecular weight of 555.64 g/mol. Its IUPAC name is 2-[3-[(4-cyanophenyl)carbamoylamino]-1-(2,2-diethoxyethyl)-2-oxoindol-3-yl]-2-(4-methylphenyl)acetamide.
| Compound Name | 2-[3-[(4-cyanophenyl)carbamoylamino]-1-(2,2-diethoxyethyl)-2-oxoindol-3-yl]-2-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 70147542 |
| Molecular Formula | C31H33N5O5 |
| Molecular Weight | 555.64 g/mol |
| Exact Mass | 555.25 |
| IUPAC Name | 2-[3-[(4-cyanophenyl)carbamoylamino]-1-(2,2-diethoxyethyl)-2-oxoindol-3-yl]-2-(4-methylphenyl)acetamide |
| SMILES | CCOC(CN1C(=O)C(NC(=O)Nc2ccc(C#N)cc2)(C(C(N)=O)c2ccc(C)cc2)c2ccccc21)OCC |
| InChI | InChI=1S/C31H33N5O5/c1-4-40-26(41-5-2)19-36-25-9-7-6-8-24(25)31(29(36)38,27(28(33)37)22-14-10-20(3)11-15-22)35-30(39)34-23-16-12-21(18-32)13-17-23/h6-17,26-27H,4-5,19H2,1-3H3,(H2,33,37)(H2,34,35,39) |
| InChIKey | DWNNHMZRJSCEPR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 146.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.64 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|