C31H34N4O7 — CID 70146495
4-[[(3S)-1-(2,2-diethoxyethyl)-3-[2-(4-methylanilino)-2-oxoethyl]-2-oxoindol-3-yl]carbamoylamino]benzoic acid (PubChem CID 70146495) has the molecular formula C31H34N4O7 and a molecular weight of 574.63 g/mol. Its IUPAC name is 4-[[(3S)-1-(2,2-diethoxyethyl)-3-[2-(4-methylanilino)-2-oxoethyl]-2-oxoindol-3-yl]carbamoylamino]benzoic acid.
| Compound Name | 4-[[(3S)-1-(2,2-diethoxyethyl)-3-[2-(4-methylanilino)-2-oxoethyl]-2-oxoindol-3-yl]carbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 70146495 |
| Molecular Formula | C31H34N4O7 |
| Molecular Weight | 574.63 g/mol |
| Exact Mass | 574.24 |
| IUPAC Name | 4-[[(3S)-1-(2,2-diethoxyethyl)-3-[2-(4-methylanilino)-2-oxoethyl]-2-oxoindol-3-yl]carbamoylamino]benzoic acid |
| SMILES | CCOC(CN1C(=O)[C@@](CC(=O)Nc2ccc(C)cc2)(NC(=O)Nc2ccc(C(=O)O)cc2)c2ccccc21)OCC |
| InChI | InChI=1S/C31H34N4O7/c1-4-41-27(42-5-2)19-35-25-9-7-6-8-24(25)31(29(35)39,18-26(36)32-22-14-10-20(3)11-15-22)34-30(40)33-23-16-12-21(13-17-23)28(37)38/h6-17,27H,4-5,18-19H2,1-3H3,(H,32,36)(H,37,38)(H2,33,34,40)/t31-/m0/s1 |
| InChIKey | SRPLSRVYMLWFKK-HKBQPEDESA-N |
| XLogP | 4.48 |
| TPSA | 146.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.63 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|