C27H27N5O4 — CID 86754506
2-[1-(2-hydroxyiminoethyl)-3-[(4-methylphenyl)carbamoylamino]-2-oxoindol-3-yl]-N-(4-methylphenyl)acetamide (PubChem CID 86754506) has the molecular formula C27H27N5O4 and a molecular weight of 485.54 g/mol. Its IUPAC name is 2-[1-(2-hydroxyiminoethyl)-3-[(4-methylphenyl)carbamoylamino]-2-oxoindol-3-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[1-(2-hydroxyiminoethyl)-3-[(4-methylphenyl)carbamoylamino]-2-oxoindol-3-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 86754506 |
| Molecular Formula | C27H27N5O4 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | 2-[1-(2-hydroxyiminoethyl)-3-[(4-methylphenyl)carbamoylamino]-2-oxoindol-3-yl]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CC2(NC(=O)Nc3ccc(C)cc3)C(=O)N(CC=NO)c3ccccc32)cc1 |
| InChI | InChI=1S/C27H27N5O4/c1-18-7-11-20(12-8-18)29-24(33)17-27(31-26(35)30-21-13-9-19(2)10-14-21)22-5-3-4-6-23(22)32(25(27)34)16-15-28-36/h3-15,36H,16-17H2,1-2H3,(H,29,33)(H2,30,31,35) |
| InChIKey | GQGOCEOAWHGMKC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|