C14H18F3NO — CID 157034638
3,3-dimethyl-1-(2,2,2-trifluoroethyl)indol-2-one;ethane (PubChem CID 157034638) has the molecular formula C14H18F3NO and a molecular weight of 273.30 g/mol. Its IUPAC name is 3,3-dimethyl-1-(2,2,2-trifluoroethyl)indol-2-one;ethane.
| Compound Name | 3,3-dimethyl-1-(2,2,2-trifluoroethyl)indol-2-one;ethane |
|---|---|
| PubChem CID | 157034638 |
| Molecular Formula | C14H18F3NO |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 3,3-dimethyl-1-(2,2,2-trifluoroethyl)indol-2-one;ethane |
| SMILES | CC.CC1(C)C(=O)N(CC(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C12H12F3NO.C2H6/c1-11(2)8-5-3-4-6-9(8)16(10(11)17)7-12(13,14)15;1-2/h3-6H,7H2,1-2H3;1-2H3 |
| InChIKey | RNWDFSQWVGVZRI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |