C18H26N2O — CID 103072771
1-[2-[(tert-butylamino)methyl]prop-2-enyl]-3,3-dimethylindol-2-one (PubChem CID 103072771) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is 1-[2-[(tert-butylamino)methyl]prop-2-enyl]-3,3-dimethylindol-2-one.
| Compound Name | 1-[2-[(tert-butylamino)methyl]prop-2-enyl]-3,3-dimethylindol-2-one |
|---|---|
| PubChem CID | 103072771 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 1-[2-[(tert-butylamino)methyl]prop-2-enyl]-3,3-dimethylindol-2-one |
| SMILES | C=C(CNC(C)(C)C)CN1C(=O)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C18H26N2O/c1-13(11-19-17(2,3)4)12-20-15-10-8-7-9-14(15)18(5,6)16(20)21/h7-10,19H,1,11-12H2,2-6H3 |
| InChIKey | UHRGRYGHNRTJHC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|