C30H27N3O — CID 121399510
2-[(2Z)-2-[[(4aR)-9-butyl-4a-methyl-3,4-dihydro-2H-carbazol-1-yl]methylidene]-3-oxoinden-1-ylidene]propanedinitrile (PubChem CID 121399510) has the molecular formula C30H27N3O and a molecular weight of 445.57 g/mol. Its IUPAC name is 2-[(2Z)-2-[[(4aR)-9-butyl-4a-methyl-3,4-dihydro-2H-carbazol-1-yl]methylidene]-3-oxoinden-1-ylidene]propanedinitrile.
| Compound Name | 2-[(2Z)-2-[[(4aR)-9-butyl-4a-methyl-3,4-dihydro-2H-carbazol-1-yl]methylidene]-3-oxoinden-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 121399510 |
| Molecular Formula | C30H27N3O |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | 2-[(2Z)-2-[[(4aR)-9-butyl-4a-methyl-3,4-dihydro-2H-carbazol-1-yl]methylidene]-3-oxoinden-1-ylidene]propanedinitrile |
| SMILES | CCCCN1C2=C(/C=C3\C(=O)c4ccccc4C3=C(C#N)C#N)CCC[C@]2(C)c2ccccc21 |
| InChI | InChI=1S/C30H27N3O/c1-3-4-16-33-26-14-8-7-13-25(26)30(2)15-9-10-20(29(30)33)17-24-27(21(18-31)19-32)22-11-5-6-12-23(22)28(24)34/h5-8,11-14,17H,3-4,9-10,15-16H2,1-2H3/b24-17-/t30-/m1/s1 |
| InChIKey | IECABKZEFQFTGG-VYASJKFVSA-N |
| XLogP | 6.63 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|