C46H30N6O2S2 — CID 164759188
CID 164759188 (PubChem CID 164759188) has the molecular formula C46H30N6O2S2 and a molecular weight of 762.92 g/mol.
| Compound Name | CID 164759188 |
|---|---|
| PubChem CID | 164759188 |
| Molecular Formula | C46H30N6O2S2 |
| Molecular Weight | 762.92 g/mol |
| Exact Mass | 762.19 |
| IUPAC Name | — |
| SMILES | N#CC(C#N)=C1/C(=C/c2nc3c(s2)C2=C(c4sc(/C=C5\C(=O)c6ccccc6C5=C(C#N)C#N)nc4C24CCCCC4)C32CCCCC2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C46H30N6O2S2/c47-21-25(22-48)35-27-11-3-5-13-29(27)39(53)31(35)19-33-51-43-42(56-33)38-37(45(43)15-7-1-8-16-45)41-44(46(38)17-9-2-10-18-46)52-34(55-41)20-32-36(26(23-49)24-50)28-12-4-6-14-30(28)40(32)54/h3-6,11-14,19-20H,1-2,7-10,15-18H2/b31-19-,32-20- |
| InChIKey | CSWOPHIBROPMSM-CDSIFPFTSA-N |
| XLogP | 10.10 |
| TPSA | 155.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.92 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|