C24H9N5OS2 — CID 170175252
2-[(2Z)-2-[[5-(4-cyanophenyl)-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]methylidene]-3-oxoinden-1-ylidene]propanedinitrile (PubChem CID 170175252) has the molecular formula C24H9N5OS2 and a molecular weight of 447.50 g/mol. Its IUPAC name is 2-[(2Z)-2-[[5-(4-cyanophenyl)-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]methylidene]-3-oxoinden-1-ylidene]propanedinitrile.
| Compound Name | 2-[(2Z)-2-[[5-(4-cyanophenyl)-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]methylidene]-3-oxoinden-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 170175252 |
| Molecular Formula | C24H9N5OS2 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.02 |
| IUPAC Name | 2-[(2Z)-2-[[5-(4-cyanophenyl)-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]methylidene]-3-oxoinden-1-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1/C(=C/c2nc3sc(-c4ccc(C#N)cc4)nc3s2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C24H9N5OS2/c25-10-13-5-7-14(8-6-13)22-29-24-23(32-22)28-19(31-24)9-18-20(15(11-26)12-27)16-3-1-2-4-17(16)21(18)30/h1-9H/b18-9- |
| InChIKey | ILMWKYARAQNLPM-NVMNQCDNSA-N |
| XLogP | 5.37 |
| TPSA | 114.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|