C24H12N2S4 — CID 168735921
2-[(5-phenyl-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl)methylidene]cyclopenta[b]naphthalene-1,3-dithione (PubChem CID 168735921) has the molecular formula C24H12N2S4 and a molecular weight of 456.64 g/mol. Its IUPAC name is 2-[(5-phenyl-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl)methylidene]cyclopenta[b]naphthalene-1,3-dithione.
| Compound Name | 2-[(5-phenyl-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl)methylidene]cyclopenta[b]naphthalene-1,3-dithione |
|---|---|
| PubChem CID | 168735921 |
| Molecular Formula | C24H12N2S4 |
| Molecular Weight | 456.64 g/mol |
| Exact Mass | 455.99 |
| IUPAC Name | 2-[(5-phenyl-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl)methylidene]cyclopenta[b]naphthalene-1,3-dithione |
| SMILES | S=C1C(=Cc2nc3sc(-c4ccccc4)nc3s2)C(=S)c2cc3ccccc3cc21 |
| InChI | InChI=1S/C24H12N2S4/c27-20-16-10-14-8-4-5-9-15(14)11-17(16)21(28)18(20)12-19-25-23-24(29-19)26-22(30-23)13-6-2-1-3-7-13/h1-12H |
| InChIKey | HNSSMPVREIGSKY-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.64 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|