C25H13NOS3 — CID 168735773
2-[(5-phenylthieno[2,3-d][1,3]oxazol-2-yl)methylidene]cyclopenta[b]naphthalene-1,3-dithione (PubChem CID 168735773) has the molecular formula C25H13NOS3 and a molecular weight of 439.59 g/mol. Its IUPAC name is 2-[(5-phenylthieno[2,3-d][1,3]oxazol-2-yl)methylidene]cyclopenta[b]naphthalene-1,3-dithione.
| Compound Name | 2-[(5-phenylthieno[2,3-d][1,3]oxazol-2-yl)methylidene]cyclopenta[b]naphthalene-1,3-dithione |
|---|---|
| PubChem CID | 168735773 |
| Molecular Formula | C25H13NOS3 |
| Molecular Weight | 439.59 g/mol |
| Exact Mass | 439.02 |
| IUPAC Name | 2-[(5-phenylthieno[2,3-d][1,3]oxazol-2-yl)methylidene]cyclopenta[b]naphthalene-1,3-dithione |
| SMILES | S=C1C(=Cc2nc3sc(-c4ccccc4)cc3o2)C(=S)c2cc3ccccc3cc21 |
| InChI | InChI=1S/C25H13NOS3/c28-23-17-10-15-8-4-5-9-16(15)11-18(17)24(29)19(23)12-22-26-25-20(27-22)13-21(30-25)14-6-2-1-3-7-14/h1-13H |
| InChIKey | IOGVNWGOQQWULH-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.59 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|