C26H15NO4S — CID 168736342
2-[[5-(4-methoxyphenyl)thieno[2,3-d][1,3]oxazol-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione (PubChem CID 168736342) has the molecular formula C26H15NO4S and a molecular weight of 437.48 g/mol. Its IUPAC name is 2-[[5-(4-methoxyphenyl)thieno[2,3-d][1,3]oxazol-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione.
| Compound Name | 2-[[5-(4-methoxyphenyl)thieno[2,3-d][1,3]oxazol-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione |
|---|---|
| PubChem CID | 168736342 |
| Molecular Formula | C26H15NO4S |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | 2-[[5-(4-methoxyphenyl)thieno[2,3-d][1,3]oxazol-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione |
| SMILES | COc1ccc(-c2cc3oc(C=C4C(=O)c5cc6ccccc6cc5C4=O)nc3s2)cc1 |
| InChI | InChI=1S/C26H15NO4S/c1-30-17-8-6-14(7-9-17)22-13-21-26(32-22)27-23(31-21)12-20-24(28)18-10-15-4-2-3-5-16(15)11-19(18)25(20)29/h2-13H,1H3 |
| InChIKey | HDAUEVXQMPWTCZ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|