C29H15NO4 — CID 168735574
2-[(5-naphthalen-2-ylfuro[2,3-d][1,3]oxazol-2-yl)methylidene]cyclopenta[b]naphthalene-1,3-dione (PubChem CID 168735574) has the molecular formula C29H15NO4 and a molecular weight of 441.44 g/mol. Its IUPAC name is 2-[(5-naphthalen-2-ylfuro[2,3-d][1,3]oxazol-2-yl)methylidene]cyclopenta[b]naphthalene-1,3-dione.
| Compound Name | 2-[(5-naphthalen-2-ylfuro[2,3-d][1,3]oxazol-2-yl)methylidene]cyclopenta[b]naphthalene-1,3-dione |
|---|---|
| PubChem CID | 168735574 |
| Molecular Formula | C29H15NO4 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | 2-[(5-naphthalen-2-ylfuro[2,3-d][1,3]oxazol-2-yl)methylidene]cyclopenta[b]naphthalene-1,3-dione |
| SMILES | O=C1C(=Cc2nc3oc(-c4ccc5ccccc5c4)cc3o2)C(=O)c2cc3ccccc3cc21 |
| InChI | InChI=1S/C29H15NO4/c31-27-21-12-18-7-3-4-8-19(18)13-22(21)28(32)23(27)14-26-30-29-25(33-26)15-24(34-29)20-10-9-16-5-1-2-6-17(16)11-20/h1-15H |
| InChIKey | HJXCWJOKLFGCDD-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 73.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|