C22H10N2O3S2 — CID 168735628
2-[[5-(1,3-thiazol-2-yl)thieno[2,3-d][1,3]oxazol-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione (PubChem CID 168735628) has the molecular formula C22H10N2O3S2 and a molecular weight of 414.47 g/mol. Its IUPAC name is 2-[[5-(1,3-thiazol-2-yl)thieno[2,3-d][1,3]oxazol-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione.
| Compound Name | 2-[[5-(1,3-thiazol-2-yl)thieno[2,3-d][1,3]oxazol-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione |
|---|---|
| PubChem CID | 168735628 |
| Molecular Formula | C22H10N2O3S2 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.01 |
| IUPAC Name | 2-[[5-(1,3-thiazol-2-yl)thieno[2,3-d][1,3]oxazol-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione |
| SMILES | O=C1C(=Cc2nc3sc(-c4nccs4)cc3o2)C(=O)c2cc3ccccc3cc21 |
| InChI | InChI=1S/C22H10N2O3S2/c25-19-13-7-11-3-1-2-4-12(11)8-14(13)20(26)15(19)9-18-24-21-16(27-18)10-17(29-21)22-23-5-6-28-22/h1-10H |
| InChIKey | IEELHIODTXXUOA-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 73.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|