C24H12N2O3S — CID 168736092
2-[(5-phenyl-[1,3]thiazolo[5,4-d][1,3]oxazol-2-yl)methylidene]cyclopenta[b]naphthalene-1,3-dione (PubChem CID 168736092) has the molecular formula C24H12N2O3S and a molecular weight of 408.44 g/mol. Its IUPAC name is 2-[(5-phenyl-[1,3]thiazolo[5,4-d][1,3]oxazol-2-yl)methylidene]cyclopenta[b]naphthalene-1,3-dione.
| Compound Name | 2-[(5-phenyl-[1,3]thiazolo[5,4-d][1,3]oxazol-2-yl)methylidene]cyclopenta[b]naphthalene-1,3-dione |
|---|---|
| PubChem CID | 168736092 |
| Molecular Formula | C24H12N2O3S |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | 2-[(5-phenyl-[1,3]thiazolo[5,4-d][1,3]oxazol-2-yl)methylidene]cyclopenta[b]naphthalene-1,3-dione |
| SMILES | O=C1C(=Cc2nc3sc(-c4ccccc4)nc3o2)C(=O)c2cc3ccccc3cc21 |
| InChI | InChI=1S/C24H12N2O3S/c27-20-16-10-14-8-4-5-9-15(14)11-17(16)21(28)18(20)12-19-25-24-22(29-19)26-23(30-24)13-6-2-1-3-7-13/h1-12H |
| InChIKey | XWSNFXADITWCIT-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 73.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|