C25H13NO5 — CID 168735929
(3Z)-3-[(5-phenylfuro[2,3-d][1,3]oxazol-2-yl)methylidene]benzo[g]chromene-2,4-dione (PubChem CID 168735929) has the molecular formula C25H13NO5 and a molecular weight of 407.38 g/mol. Its IUPAC name is (3Z)-3-[(5-phenylfuro[2,3-d][1,3]oxazol-2-yl)methylidene]benzo[g]chromene-2,4-dione.
| Compound Name | (3Z)-3-[(5-phenylfuro[2,3-d][1,3]oxazol-2-yl)methylidene]benzo[g]chromene-2,4-dione |
|---|---|
| PubChem CID | 168735929 |
| Molecular Formula | C25H13NO5 |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | (3Z)-3-[(5-phenylfuro[2,3-d][1,3]oxazol-2-yl)methylidene]benzo[g]chromene-2,4-dione |
| SMILES | O=C1Oc2cc3ccccc3cc2C(=O)/C1=C/c1nc2oc(-c3ccccc3)cc2o1 |
| InChI | InChI=1S/C25H13NO5/c27-23-17-10-15-8-4-5-9-16(15)11-20(17)31-25(28)18(23)12-22-26-24-21(29-22)13-19(30-24)14-6-2-1-3-7-14/h1-13H/b18-12- |
| InChIKey | WBFINWQJTNGAOH-PDGQHHTCSA-N |
| XLogP | 5.43 |
| TPSA | 82.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|