C20H11NO5S — CID 168736305
(2E)-1,1-dioxo-2-[(5-phenylfuro[2,3-d][1,3]oxazol-2-yl)methylidene]-1-benzothiophen-3-one (PubChem CID 168736305) has the molecular formula C20H11NO5S and a molecular weight of 377.38 g/mol. Its IUPAC name is (2E)-1,1-dioxo-2-[(5-phenylfuro[2,3-d][1,3]oxazol-2-yl)methylidene]-1-benzothiophen-3-one.
| Compound Name | (2E)-1,1-dioxo-2-[(5-phenylfuro[2,3-d][1,3]oxazol-2-yl)methylidene]-1-benzothiophen-3-one |
|---|---|
| PubChem CID | 168736305 |
| Molecular Formula | C20H11NO5S |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | (2E)-1,1-dioxo-2-[(5-phenylfuro[2,3-d][1,3]oxazol-2-yl)methylidene]-1-benzothiophen-3-one |
| SMILES | O=C1/C(=C\c2nc3oc(-c4ccccc4)cc3o2)S(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C20H11NO5S/c22-19-13-8-4-5-9-16(13)27(23,24)17(19)11-18-21-20-15(25-18)10-14(26-20)12-6-2-1-3-7-12/h1-11H/b17-11+ |
| InChIKey | NUDFYTVZHYBMEV-GZTJUZNOSA-N |
| XLogP | 4.10 |
| TPSA | 90.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|