C19H11ClO6S2 — CID 91384916
2-[2-chloro-3-(1,1,3-trioxo-1-benzothiophen-2-ylidene)propylidene]-1,1-dioxo-1-benzothiophen-3-one (PubChem CID 91384916) has the molecular formula C19H11ClO6S2 and a molecular weight of 434.88 g/mol. Its IUPAC name is 2-[2-chloro-3-(1,1,3-trioxo-1-benzothiophen-2-ylidene)propylidene]-1,1-dioxo-1-benzothiophen-3-one.
| Compound Name | 2-[2-chloro-3-(1,1,3-trioxo-1-benzothiophen-2-ylidene)propylidene]-1,1-dioxo-1-benzothiophen-3-one |
|---|---|
| PubChem CID | 91384916 |
| Molecular Formula | C19H11ClO6S2 |
| Molecular Weight | 434.88 g/mol |
| Exact Mass | 433.97 |
| IUPAC Name | 2-[2-chloro-3-(1,1,3-trioxo-1-benzothiophen-2-ylidene)propylidene]-1,1-dioxo-1-benzothiophen-3-one |
| SMILES | O=C1C(=CC(Cl)C=C2C(=O)c3ccccc3S2(=O)=O)S(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C19H11ClO6S2/c20-11(9-16-18(21)12-5-1-3-7-14(12)27(16,23)24)10-17-19(22)13-6-2-4-8-15(13)28(17,25)26/h1-11H |
| InChIKey | TYWOGCBICNKHLA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.88 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|