C9H4Br2O3S — CID 12614496
2,3-dibromo-1,1-dioxothiochromen-4-one (PubChem CID 12614496) has the molecular formula C9H4Br2O3S and a molecular weight of 352.00 g/mol. Its IUPAC name is 2,3-dibromo-1,1-dioxothiochromen-4-one.
| Compound Name | 2,3-dibromo-1,1-dioxothiochromen-4-one |
|---|---|
| PubChem CID | 12614496 |
| Molecular Formula | C9H4Br2O3S |
| Molecular Weight | 352.00 g/mol |
| Exact Mass | 349.82 |
| IUPAC Name | 2,3-dibromo-1,1-dioxothiochromen-4-one |
| SMILES | O=C1C(Br)=C(Br)S(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C9H4Br2O3S/c10-7-8(12)5-3-1-2-4-6(5)15(13,14)9(7)11/h1-4H |
| InChIKey | RDOSBGPIWWBPBR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.00 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |