C16H16O3S — CID 145125707
ethane;2-methyl-10,10-dioxothioxanthen-9-one (PubChem CID 145125707) has the molecular formula C16H16O3S and a molecular weight of 288.37 g/mol. Its IUPAC name is ethane;2-methyl-10,10-dioxothioxanthen-9-one.
| Compound Name | ethane;2-methyl-10,10-dioxothioxanthen-9-one |
|---|---|
| PubChem CID | 145125707 |
| Molecular Formula | C16H16O3S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | ethane;2-methyl-10,10-dioxothioxanthen-9-one |
| SMILES | CC.Cc1ccc2c(c1)C(=O)c1ccccc1S2(=O)=O |
| InChI | InChI=1S/C14H10O3S.C2H6/c1-9-6-7-13-11(8-9)14(15)10-4-2-3-5-12(10)18(13,16)17;1-2/h2-8H,1H3;1-2H3 |
| InChIKey | RNVZPMRSAOUURG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |