1,3-dimethyldibenzothiophene 5,5-dioxide

C14H12O2S — CID 58420751

IUPAC1,3-dimethyldibenzothiophene 5,5-dioxide
SMILESCc1cc(C)c2c(c1)S(=O)(=O)c1ccccc1-2
InChIInChI=1S/C14H12O2S/c1-9-7-10(2)14-11-5-3-4-6-12(11)17(15,16)13(14)8-9/h3-8H,1-2H3
InChIKeyKWQMXUHRJPLORN-UHFFFAOYSA-N
MW244.31 g/mol
LogP3.12
Rot. Bonds

About 1,3-dimethyldibenzothiophene 5,5-dioxide

1,3-dimethyldibenzothiophene 5,5-dioxide (PubChem CID 58420751) has the molecular formula C14H12O2S and a molecular weight of 244.31 g/mol. Its IUPAC name is 1,3-dimethyldibenzothiophene 5,5-dioxide.

Molecular Properties

Compound Name1,3-dimethyldibenzothiophene 5,5-dioxide
PubChem CID58420751
Molecular FormulaC14H12O2S
Molecular Weight244.31 g/mol
Exact Mass244.06
IUPAC Name1,3-dimethyldibenzothiophene 5,5-dioxide
SMILESCc1cc(C)c2c(c1)S(=O)(=O)c1ccccc1-2
InChIInChI=1S/C14H12O2S/c1-9-7-10(2)14-11-5-3-4-6-12(11)17(15,16)13(14)8-9/h3-8H,1-2H3
InChIKeyKWQMXUHRJPLORN-UHFFFAOYSA-N
XLogP3.12
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.31
LogP ≤ 53.12
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze 1,3-dimethyldibenzothiophene 5,5-dioxide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,3-dimethyldibenzothiophene 5,5-dioxide?
The IUPAC name of 1,3-dimethyldibenzothiophene 5,5-dioxide (CID 58420751) is 1,3-dimethyldibenzothiophene 5,5-dioxide.
What is the SMILES notation for 1,3-dimethyldibenzothiophene 5,5-dioxide?
The canonical SMILES for 1,3-dimethyldibenzothiophene 5,5-dioxide is Cc1cc(C)c2c(c1)S(=O)(=O)c1ccccc1-2.
What is the InChIKey of 1,3-dimethyldibenzothiophene 5,5-dioxide?
The InChIKey is KWQMXUHRJPLORN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O2S/c1-9-7-10(2)14-11-5-3-4-6-12(11)17(15,16)13(14)8-9/h3-8H,1-2H3.
What are the key properties of 1,3-dimethyldibenzothiophene 5,5-dioxide?
1,3-dimethyldibenzothiophene 5,5-dioxide has a molecular weight of 244.31 g/mol, XLogP of 3.12, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyldibenzothiophene 5,5-dioxide is sourced from PubChem (CID 58420751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).