C14H12O2S — CID 58420751
1,3-dimethyldibenzothiophene 5,5-dioxide (PubChem CID 58420751) has the molecular formula C14H12O2S and a molecular weight of 244.31 g/mol. Its IUPAC name is 1,3-dimethyldibenzothiophene 5,5-dioxide.
| Compound Name | 1,3-dimethyldibenzothiophene 5,5-dioxide |
|---|---|
| PubChem CID | 58420751 |
| Molecular Formula | C14H12O2S |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 1,3-dimethyldibenzothiophene 5,5-dioxide |
| SMILES | Cc1cc(C)c2c(c1)S(=O)(=O)c1ccccc1-2 |
| InChI | InChI=1S/C14H12O2S/c1-9-7-10(2)14-11-5-3-4-6-12(11)17(15,16)13(14)8-9/h3-8H,1-2H3 |
| InChIKey | KWQMXUHRJPLORN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |