C15H15OP — CID 68744972
1,3,5-trimethyl-2-(2-phosphorosophenyl)benzene (PubChem CID 68744972) has the molecular formula C15H15OP and a molecular weight of 242.26 g/mol. Its IUPAC name is 1,3,5-trimethyl-2-(2-phosphorosophenyl)benzene.
| Compound Name | 1,3,5-trimethyl-2-(2-phosphorosophenyl)benzene |
|---|---|
| PubChem CID | 68744972 |
| Molecular Formula | C15H15OP |
| Molecular Weight | 242.26 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 1,3,5-trimethyl-2-(2-phosphorosophenyl)benzene |
| SMILES | Cc1cc(C)c(-c2ccccc2P=O)c(C)c1 |
| InChI | InChI=1S/C15H15OP/c1-10-8-11(2)15(12(3)9-10)13-6-4-5-7-14(13)17-16/h4-9H,1-3H3 |
| InChIKey | GUWKXVOGDCUUQF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.26 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|