C38H35P — CID 101269053
1-[2,6-bis(2,4,6-trimethylphenyl)phenyl]-2,3-diphenylphosphirene (PubChem CID 101269053) has the molecular formula C38H35P and a molecular weight of 522.67 g/mol. Its IUPAC name is 1-[2,6-bis(2,4,6-trimethylphenyl)phenyl]-2,3-diphenylphosphirene.
| Compound Name | 1-[2,6-bis(2,4,6-trimethylphenyl)phenyl]-2,3-diphenylphosphirene |
|---|---|
| PubChem CID | 101269053 |
| Molecular Formula | C38H35P |
| Molecular Weight | 522.67 g/mol |
| Exact Mass | 522.25 |
| IUPAC Name | 1-[2,6-bis(2,4,6-trimethylphenyl)phenyl]-2,3-diphenylphosphirene |
| SMILES | Cc1cc(C)c(-c2cccc(-c3c(C)cc(C)cc3C)c2P2C(c3ccccc3)=C2c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C38H35P/c1-24-20-26(3)34(27(4)21-24)32-18-13-19-33(35-28(5)22-25(2)23-29(35)6)38(32)39-36(30-14-9-7-10-15-30)37(39)31-16-11-8-12-17-31/h7-23H,1-6H3 |
| InChIKey | FPXMZENYVWMSHA-UHFFFAOYSA-N |
| XLogP | 10.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.67 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|