C15H18O — CID 130423762
1,2,5-trimethyl-3-phenylbenzene;hydrate (PubChem CID 130423762) has the molecular formula C15H18O and a molecular weight of 214.31 g/mol. Its IUPAC name is 1,2,5-trimethyl-3-phenylbenzene;hydrate.
| Compound Name | 1,2,5-trimethyl-3-phenylbenzene;hydrate |
|---|---|
| PubChem CID | 130423762 |
| Molecular Formula | C15H18O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 1,2,5-trimethyl-3-phenylbenzene;hydrate |
| SMILES | Cc1cc(C)c(C)c(-c2ccccc2)c1.O |
| InChI | InChI=1S/C15H16.H2O/c1-11-9-12(2)13(3)15(10-11)14-7-5-4-6-8-14;/h4-10H,1-3H3;1H2 |
| InChIKey | JEMSLKUKOOPKGT-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |